
kemiallinen yhdiste

Fenoliftaleiini (C20H14O4) on väriaine, jota käytetään muun muassa pH-indikaattorina [4]. Aine on yksi käytetyimmistä indikaattoreista esimerkiksi titrauksessa sen sopivan värinmuutosalueen vuoksi [5]. Fenoliftaleiini on äärimmäisen happamissa oloissa oranssia, neutraaleissa tai lievemmin happamissa väritöntä. Emästen vaikutuksesta se muuttuu punaiseksi pH:n ollessa 8,2–10,0 [6] ja muuttuu jälleen värittömäksi erittäin emäksisissä oloissa [5]. Fenoliftaleiinia käytetään useissa yleisindikaattoriliuoksissa yhdessä metyylipunaisen, bromitymolisinisen ja tymolisinisen kanssa [7].

CAS-numero 77-09-8
IUPAC-nimi 3,3-bis(4-hydroksifenyyli)-2-bentsofuran-1-oni
SMILES C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O [1]
Kemiallinen kaava C20H14O4
Moolimassa 318,312 g/mol
Tiheys 1,277 g/cm³
Sulamispiste 262,5 °C[2]
Liukoisuus Ei liukene veteen


Muoto H3In+ H2In In2− In(OH)3−
Rakenne Phenolphthalein-very-low-pH-2D-skeletal.png Phenolphthalein-low-pH-2D-skeletal.svg Phenolphthalein-mid-pH-2D-skeletal.svg Phenolphthalein-high-pH-2D-skeletal.svg
Pallotikkumalli Phenolphthalein-orange-very-low-pH-3D-balls.png Phenolphthalein-colourless-low-pH-3D-balls.png Phenolphthalein-red-mid-pH-3D-balls.png Phenolphthalein-colourless-high-pH-3D-balls.png
pH < 0 0−8,2 8,2−10,0 >12,0
Olosuhteet vahvasti hapan hapan tai neutraali emäksinen vahvasti emäksinen
Väri oranssi
vaaleanpunaisesta fuksiaan väritön
Kuva Phenolphthalein-in-conc-sulfuric-acid.jpg Phenolphthalein-at-pH-9.jpg

Fenoliftaleiinia käytetään myös lääketieteessä. Aine oli yksi ensimmäisistä keinotekoisesti valmistetuista ulostuslääkkeistä ja sen laksatiivinen vaikutus huomattiin vuonna 1902. Myöhemmin aineen käytöstä kuitenkin luovuttiin, koska sen arveltiin aiheuttavan vaurioita maksassa.[8] Fenoliftaleiinilla on sukusolujen perimää ja lisääntymiskykyä vaarantavia sekä syöpää aiheuttavia vaikutuksia.[3]


Fenoliftaleiinia valmistetaan ftaalianhydridistä ja fenolista kuumentamalla niitä happamissa olosuhteissa.

Katso myösMuokkaa


  1. Phenolphthalein - Compound summary NCBI. Viitattu 30. syyskuuta 2008.
  2. Physical properties:Phenolphthalein NLM Viitattu 30.9.2008
  3. a b Fenoliftaleiini Käyttöturvallisuustiedote. 5.1.2018. Sigma Aldrich (Merck). Viitattu 30.5.2018. (suomeksi)
  4. värejä... F Coloria.net Päivi Hintsanen. Viitattu 30. syyskuuta 2008.
  5. a b Aroluoma, Kanerva, Karkela, Lampinselkä, Mäkelä, Sorjonen & Vakkilainen: Kemisti 5:Reaktiot ja tasapaino. WSOY, 2007.
  6. Liste des indicateurs colorés SBEC. Viitattu 30. syyskuuta 2008.
  7. Universal Indicator ISCID Encyclopedia of Science and Philosophy. Viitattu 30. syyskuuta 2008.
  8. Ruonasulatuskanavan lääkkeet Medcina. Viitattu 30. syyskuuta 2008.

Aiheesta muuallaMuokkaa

Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.