Estroni

kemiallinen yhdiste

Estroni (C18H22O2) on yksi estrogeenihormoneista. Kolmesta estrogeenihormonista estronia esiintyy naisen ruumiissa vähiten. Estronin johdannaisesta estronisulfaatista voidaan tuottaa estradiolia.

Estroni
Estron.svg
Tunnisteet
CAS-numero 53-16-7
SMILES CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)O
Ominaisuudet
Kemiallinen kaava C18H22O2
Moolimassa 270,366 g/mol
Sulamispiste 254,5 °C
Liukoisuus Veteen 30 mg/l (25 °C)[1]

Estronin moolimassa on 270,366 g/mol, sulamispiste 254,5 °C ja CAS-numero 53-16-7.

BiosynteesiMuokkaa

 
Androstenedioinin reaktio estroniksi

Estronia tuotetaan munasarjoissa aromataasin avulla androstenedionista estroniksi. Reaktiossa androstenedionin yhdeksästoista hiiliatomi poistetaan demetylaatioreaktiolla.

Katso myösMuokkaa

LähteetMuokkaa

  1. Estrone NLM Viitattu 13.06.2012

Aiheesta muuallaMuokkaa

Tämä biologiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.