Avaa päävalikko

Estradioli

kemiallinen yhdiste

Estradioli kuuluu estrogeenihormonien ryhmään.[2] Sitä syntyy munarakkulassa[2] sekä aivokuorella[3].

Estradioli
Estradiol.svg
Tunnisteet
CAS-numero 50-28-2
SMILES CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O
Ominaisuudet
Kemiallinen kaava C18H24O2
Moolimassa 272,39 g/mol
Sulamispiste 173 °C
Liukoisuus Veteen 3,6 mg/l (27 °C)[1]

Estradioli ohjaa elimistön kehittymistä naisen suuntaan ja aiheuttaa naisen sukupuoliominaisuudet.[2] Estradioli on tärkein naishormoni,[4] mutta sitä on pieniä määriä myös miesten elimistössä. Estradioli parantaa aivojen verenkiertoa ja muistia[5]tarvitaan parempi lähde. Tämä saattaa selittää sen, miksi estradioli nopeuttaa hermoimpulssien kulkua aivoissa[3]. Lisäksi se lisää aivojen serotoniini-, dopamini- ja norepinefriinipitoisuuksia, mikä sekin saa aivot toimimaan tehokkaammin[3].

Verenkierrossa olevan estradiolin määrässä on suurta yksilöllistä vaihtelua[6]. Estradiolin kemiallinen kaava on C18H24O2, moolimassa 272,39 g/mol, sulamispiste 173 °C ja CAS-numero 50-28-2.

Katso myösMuokkaa

LähteetMuokkaa

  1. Estradiol NLM. Viitattu 13.6.2012.
  2. a b c Turunen, Seppo: Biologia: Ihminen, s. 176. 5.–7. painos. WSOY, 2007. ISBN 978-951-0-29701-8.
  3. a b c Roggli, Linda: The estrogen connection to ADHD. SelfGrowth.com.
  4. Psyko [vanhentunut linkki]
  5. Miten tiede selittää paremman suoritustason urheiltaessa kuukautisten aikana. https://www.libresse.fi/meidan-maailma/urheilu-kuukautisten-aikana/
  6. Vihko, Kimmo: Voisiko tämä olla vaihdevuosioireilua? Tietopulssi 4/2004. [vanhentunut linkki]

Aiheesta muuallaMuokkaa