Trifenyylifosfiini

kemiallinen yhdiste

Trifenyylifosfiini eli trifenyylifosfori (C18H15P) on yleisesti käytetty orgaaninen fosforiyhdiste. Ainetta käytetään laajasti orgaanisten ja organometalliyhdisteiden synteesissä. Trifenyylifosfori kirjoitetaan yleisesti lyhennettynä muotoon PPh3 tai Ph3P. Huoneenlämpötilassa trifenyylifosfiinin on veteen liukenemattomia värittömiä kiteitä[2]. Trifenyylifosfiini voidaan liuottaa poolittomiin liuottimiin kuten bensiiniin tai dietyylieetteriin. Trifenyylifosfiinin metallijohdannaisia käytetään usein katalyytteinä.

Trifenyylifosfiini
Tunnisteet
CAS-numero 603-35-0
PubChem CID 11776
SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 [1]
Ominaisuudet
Molekyylikaava C18H15P
Moolimassa 262,27 g/mol
Sulamispiste 80 °C [2]
Kiehumispiste 377 °C
Tiheys 1,1
Liukoisuus veteen Veteen liukenematon

Reaktioita Muokkaa

Trifenyylifosfiinin hapettuminen Muokkaa

Trifenyylifosfiini reagoi hitaasti ilmassa muodostaen trifenyylifosfiinioksidia

2 PPh3 + O2 → 2 OPPh3

Yksi tapa hapettaa trifenyylifosfiinia on myös sen reaktio orgaanisten peroksidien kanssa.

PPh3 + RO2H → OPPh3 + ROH

Staudinger-reaktio Muokkaa

Staudinger-reaktiossa atsideista tehdään amiineja usean katalyytin avulla. Trifenyylifosfiini muodostaa atsidin kanssa fosfatsidin, jonka menettäessä typpimolekyyli syntyy iminofosforaani. Iminofosforaaniin lisättäessä vettä se hajoaa muodostaen amiinin.[3]

PPh3 + PhN3 → PhNPPh3 + N2
PPh3 + RN3 + H2O → OPPh3 + N2 + RNH2

Appel-reaktio Muokkaa

Appel-reaktiossa trifenyylifosfiini hapettuu ensin trifenyylifosfiinioksidiksi, joka katalysoi alkoholin reaktiota alkyylihalidiksi yleensä bromidiksi tai kloridiksi.[4]

PPh3 + CBr4 + RCH2OH → OPPh3 + RCH2Br + HCBr3

Turvallisuus Muokkaa

Trifenyylifosfiini ärsyttää hengitysteitä ja silmiä. Aine on palavaa ja voi muodostaa myrkyllisiä palokaasuja kuten fosfiinia sekä fosforin oksideja.[2]

Lähteet Muokkaa

  1. Triphenylphosphine - Compound summary NCBI. Viitattu 18. lokakuuta 2008.
  2. a b c Trifenyylifosfiinin kansainvälinen kemikaalikortti Luettu 18. lokakuuta 2008
  3. Staudinger Reaction Organic Chemistry Portal. Viitattu 18. lokakuuta 2008.
  4. Appel Reaction Organic Chemistry Portal. Viitattu 18. lokakuuta 2008.