Avaa päävalikko

Luminoli

kemiallinen yhdiste

Luminoli (5-Amino-2,3-dihydro-1,4-ftaaliatsiinidioni eli C8H7N3O2) on kemiallinen yhdiste, jolla saadaan aikaan kemiluminesenssi, eli luminesenssi-ilmiö, jossa se vapauttaa kirkkaan sinistä valoa. Reaktiossa valon lisäksi ei kuitenkaan vapaudu lämpöä.

Luminoli
Luminol.png
Tunnisteet
CAS-numero 521-31-3
IUPAC-nimi 5-Amino-2,3-dihydro-1,4-ftaaliatsiinidioni
SMILES C1=CC2=C(C(=C1)N)C(=O)NNC2=O
Ominaisuudet
Kemiallinen kaava C8H7N3O2
Moolimassa 177,16 g/mol
Sulamispiste 319 °C

Usein kemiluminesenssin aikaansaamiseksi käytetään vetyperoksidia (H2O2) ja jotain hydroksidia veteen liuenneena sekä katalyyttinä toimivaa metallia esimerkiksi rautaa. Katalyytin avulla vetyperoksidi hajotetaan hapeksi ja vedeksi. Katalyyttina saattaa toimia muun muassa veren hemoglobiinin sisältämä rauta ja bioluminesenssissä usein katalyyttinä toimivat erilaiset biologiset entsyymit.

Luminolin moolimassa on 177,16 g/mol, sulamispiste 319 °C ja CAS-numero 521-31-3.

Kemiluminesenssi luminolillaMuokkaa

Luminoli + H2O2 + OH- (+ katalyytti) → Virittynyt Dianioni (3-aminoftaaliatsiini) + O2 → 3-aminoftaaliatsiini + valoa + N2 + H2O (+ katalyytti)

 
Luminolin avulla aikaansaatu kemiluminesenssi, jossa vapautuu valoa (hv)
 
Luminoli ja hemoglobiini.

Luminolin käyttötavatMuokkaa

Luminolia hyödynnetään muun muassa verijälkien löytämiseksi poliisitutkinnassa. Tässä kemiluminesenssissä katalyyttinä on veren hemoglobiinin sisältämä rauta. Valotikuissa käytetään useimmiten dibentsoyyliperoksidia (kauppanimi Cyalume), joka aiheuttaa vetyperoksidin kanssa kemiluminesenssin.

Aiheesta muuallaMuokkaa

Katso myösMuokkaa