Avaa päävalikko


kemiallinen yhdiste

1,3-bisfosfoglyseraatti (C3H8O10P2) on orgaaninen molekyyli, joka esiintyy välituotteena niin glykolyysissä kuin Calvinin syklissä yhteyttämisen aikana.[2] [3]

CAS-numero 1981-49-3
IUPAC-nimi Fosfono-2-hydroksi-3-fosfono-oksipropanoaatti
SMILES C(C(C(=O)OP(=O)(O)O)O)OP(=O)(O)O [1]
Kemiallinen kaava C3H8O10P2
Moolimassa 266,034 g/mol

Roolit bioreaktioissaMuokkaa


Glykolyysissä syntynyt glyseraldehydi-3-fosfaatti muutetaan glyseraldehydi-3-fosfaattidehydrogenaasientsyymillä 1,3-bifosfoglyseraatiksi. Samalla reaktiossa mukana ollut NAD+ pelkistyy NADH:ksi. 1,3-bisfosfoglyseraatti reagoi ADP:n kanssa fosfoglyseraattikinaasientsyymin avulla, jolloin syntyy 3-fosfoglyseraattia ja ATP-molekyyli. Tämä reaktio on palautuva[2]

1,3-bisfosfoglyseraatti + ADP 3-fosfoglyseraatti + ATP

Calvinin sykliMuokkaa

Calvinin syklissä reagoivat samat yhdisteet, mutta reaktio on käänteinen glykolyysille. 3-fosfoglyseraatti muuntuu entsyymien avustuksella 1,3-bisfosfoglyseraatiksi ja samalla myös ATP muuttuu ADP:ksi. 1,3-bisfosfoglyseraatti muuttuu glyseraldehydi-3-fosfaatiksi ja dihydroksiasetonifosfaatiksi. Tässä reaktiossa NADH hapettuu NAD+:ksi.[3]


  1. Glycerate 1,3-biphosphate – Substance summary NCBI. Viitattu 8. tammikuuta 2009.
  2. a b Glycolysis and Fermentation Rensselaer Polytechnic Institute. Viitattu 8.1.2009. (englanniksi)
  3. a b Calvin cycle Bio-Medicine. Viitattu 8.1.2009.
Tämä kemiaan liittyvä artikkeli on tynkä. Voit auttaa Wikipediaa laajentamalla artikkelia.