Ero sivun ”C-vitamiini” versioiden välillä

1 merkki lisätty ,  7 vuotta sitten
ei muokkausyhteenvetoa
p (→‎Aiheesta muualla: Vanhentuneen ja toimimatoman linkin poisto)
| smiles = C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O
| kaava = C6H8O6
| moolimassa = 176,12124 g/mol
| ulkomuoto =
| sulamispiste = 190–192 °C
Rekisteröitymätön käyttäjä