Ero sivun ”Guanosiinitrifosfaatti” versioiden välillä

380 merkkiä lisätty ,  9 vuotta sitten
Malline
p (r2.7.1) (Botti lisäsi: fa:تری‌فسفات گوانوزین)
(Malline)
{{Orgaaninen yhdiste
[[Kuva:GTP_chemical_structure.png|thumb|256px|GTP:n kemiallinen rakenne]]
| nimi = Guanosiinitrifosfaatti
 
| iupac =
| kuva = [[Kuva:GTP_chemical_structure.png|200px]]
| cas = 86-01-1
| kaava = C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>14</sub>P<sub>3</sub>
| massa = 523,18
| tiheys =
| sulamispiste =
| kiehumispiste =
| liukoisuus =
| smiles = C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N
}}
'''Guanosiinitrifosfaatti''' (guanosiini-5'-trifosfaatti, '''GTP''') on eräs [[puriini]][[nukleotidi]]. GTP toimii substraattina [[RNA]]-synteesissä, samoin kuin [[adenosiinitrifosfaatti]] eli ATP, [[sytidiinitrifosfaatti]] eli CTP ja [[uridiinitrifosfaatti]] eli UTP. GTP on [[guanidiini]]nukleotidi kuten [[guanosiinidifosfaatti]] eli GDP, josta se poikeaa ainoastaan [[fosfaatti]]ryhmien lukumäärän perusteella. GTP toimii myös energianlähteenä ja useiden [[aineenvaihdunta|metabolia]]reaktioiden aktivaattorina. GTP:llä on myös tärkeä tehtävä [[G-proteiini]]en signaalivälityksessä, jossa se muuntuu GDP:ksi [[GTPaasi]]en välityksellä.
 
133 230

muokkausta