Protiokonatsoli

kemiallinen yhdiste

Protiokonatsolia käytetään maataloudessa punahomeiden ehkäisyyn.[2] Protiokonatsolin kemiallinen kaava on C14H15Cl2N3OS, moolimassa 344,259 g/mol ja CAS-numero 178928-70-6. Kemikaalin käyttö on luvanvaraista: lupa voidaan myöntää ainoastaan käyttöön sienitautien torjunta-aineena.[3]

Protiokonatsoli
Prothioconazole.png
Tunnisteet
CAS-numero 178928-70-6
IUPAC-nimi 2-[2-(1-kloorisyklopropyyli)-3-(2-kloorifenyyli)-2-hydroksipropyyli]-1H-1,2,4-triatsoli-3-tioni
SMILES C1CC1(C(CC2=CC=CC=C2Cl)(CN3C(=S)N=CN3)O)Cl
Ominaisuudet
Kemiallinen kaava C14H15Cl2N3OS
Moolimassa 344,259 g/mol
Tiheys 1,36[1] g/cm³
Sulamispiste 141,88 °C[1]

LähteetMuokkaa

  1. a b Franz Müller, Peter Ackermann & Paul Margot: Fungicides, Agricultural, 2. Individual Fungicides, Ullmann's Encyclopedia of Industrial Chemistry, John Wiley & Sons, New York, 2011. viitattu 15.01.2013
  2. MMM:n julkaisu, vilja-alan yhteistyöryhmä
  3. Maa- ja metsätalousministeriön asetus nro 4/09

Aiheesta muuallaMuokkaa