Trikodermiini

kemiallinen yhdiste

Trikodermiini on homemyrkky, joka kuuluu trikotekeenien ryhmään. Sitä on havaittu muodostuvan Trichoderma viride ja Stachybotrys chartarum -sienten aineenvaihduntatuotteena. Sieni on yleinen kosteusvaurioituneiden rakennusten homelaji.[1]

Trikodermiini
Trichodermin.png
Tunnisteet
CAS-numero 4682-50-2
IUPAC-nimi [(1S,2R,7R,9R,11R,12S)-1,2,5-trimetyylispiro[8-oksatrisyklo[7.2.1.02,7]dodek-5-eeni-12,2'-oksiraani]-11-yyli]asetaatti
SMILES CC1=CC2C(CC1)(C3(C(CC(C34CO4)O2)OC(=O)C)C)C
Ominaisuudet
Kemiallinen kaava C17H24O4
Moolimassa 292,37 g/mol
Sulamispiste 319–320 °C

LähteetMuokkaa

Aiheesta muuallaMuokkaa