Ero sivun ”Neosalvarsaani” versioiden välillä

Ei muutosta koossa ,  1 vuosi sitten
| PubChem = 23690446
| DrugBank =
| C=13 | H=13 | As=12 | S=1 | N=4 | O=4 | Na=1
| moolimassa = 466,15
| smiles = C1=CC(=C(C=C1[As]=[As]C2=CC(=C(C=C2)O)NCS(=O)[O-])N)O.[Na+]
20 331
