Ero sivun ”Kurkumiini” versioiden välillä

1 merkki poistettu ,  2 vuotta sitten
p
ei muokkausyhteenvetoa
p (Botti päivitti mallineen.)
p
| smiles = COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O
}}
 
'''Kurkumiini''' eli '''diferoyylimetaani''' on [[maustekurkuma]]n (''Curcuma longa'') juurista uutettavaa ainetta, jota käytetään [[elintarvike|elintarvikkeissa]] väriaineena. Kurkumiinin [[E-koodi]] on E 100.