Ero sivun ”Kurkumiini” versioiden välillä

95 merkkiä poistettu ,  3 vuotta sitten
p
Botti päivitti mallineen.
(Linkkiä paranneltu)
p (Botti päivitti mallineen.)
{{Orgaaninen yhdiste
| nimi = Kurkumiini
| iupac = (1''E'',6''E'')-1,7-bis(4-hydroksi-3-metoksifenyyli)hepta-1,6-dieeni-3,5-dioni
| kuva = [[Kuva:CurcuminKeto.svg|200px]]
| cas = 458-37-7
| kaava = C<sub>21</sub>H<sub>20</sub>O<sub>6</sub>
| massa = 368,38 g/mol
| tiheys =
| sulamispiste = 183 °C
| kiehumispiste =
| liukoisuus = =
| smiles = COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O
}}
 
38 803

muokkausta