Ero sivun ”Tsearalenoni” versioiden välillä

96 merkkiä poistettu ,  3 vuotta sitten
p
Botti päivitti mallineen.
(svg)
p (Botti päivitti mallineen.)
{{Orgaaninen yhdiste
| nimi = Tsearalenoni
| iupac = 3,4,5,6,9,10-heksahydro-14,16-dihydroksi-3-metyyli-[''S''-(''E'')]-1''H''-2-bentso-oksasyklo-tetradesiini-1,7-(8''H'')-dioni
| kuva = [[Kuva:Zearalenone.svg|250px]]
| cas = 17924-92-4
| kaava = C<sub>18</sub>H<sub>22</sub>O<sub>5</sub>
| massa = 318,36
| tiheys =
| sulamispiste = 162-163 °C
| kiehumispiste =
| liukoisuus =
| smiles = CC1CCCC(=O)CCCC=CC2=CC(=CC(=C2C(=O)O1)O)O
}}
'''Tsearalenoni''' usein myös '''zearalenoni''' (''3,4,5,6,9,10-heksahydro-14,16-dihydroksi-3-metyyli-[S-(E)]-1H-2-bentso-oksasyklo-tetradesiini-1,7-(8H)-dioni'') on kemialliselta rakenteeltaan resorisyklinen [[laktoni]]. Se muodostaa valkoisia kiteitä, jotka eivät liukene veteen. Tsearalenoni on hyvin stabiili yhdiste, eikä se hajoa korkeissakaan lämpötiloissa. Tsearalenonia saadaan esimerkiksi [[Gibberella zeae]] ja [[Fusarium culmorumin]] [[home]]ista. Tsearalenonia voi löytyä [[maissi]]sta, [[kaura]]sta, [[ohra]]sta, [[vehnä]]stä sekä myös mm. [[soijapapu|soijapavuista]].
38 599

muokkausta