Avaa päävalikko

Muutokset

1 merkki lisätty ,  2 vuotta sitten
p
ei muokkausyhteenvetoa
{{Orgaaninen yhdiste|
|nimi=Sorbitoli|
|iupac=Heksahydrialkoholi|
|cas = 50-70-4|
|kuva=[[Kuva:Sorbitol_Fischer_projection.png|x150px]]<br />[[Kuva:Sorbitol.png|200px]]|
|kuva2=[[Kuva:Sorbitol.png|200px]]
|kaava=C<sub>6</sub>H<sub>14</sub>O<sub>6</sub>|
|massa=182,17|
sulamispiste=95 °C |
kiehumispiste|sulamispiste=29595 °C |
|kiehumispiste=295 °C
|tiheys=1,5 |
|liukoisuus=2200 g/l veteen (20°C)|
|smiles=OCC(O)C(O)C(O)C(O)CO
}}
 
'''Sorbitoli''' (D-glusitoli, D-sorbitoli) on [[sokerialkoholi]], jota käytetään [[makeutusaine]]ena mm. [[purukumi|purukumeissa]], [[pastilli|pastilleissa]] ja [[lääke|lääkkeissä]].<ref>{{Verkkoviite | Osoite = http://kappa.ttl.fi/kemikaalikortit/khtml/nfin0892.htm | Nimeke = D-sorbitoli | Selite = | Julkaisu = Kemikaalikortit | Ajankohta = 2002 | Julkaisija =TTL | Viitattu =6.8.2013 }}</ref><ref>{{Verkkoviite | Osoite = http://www.terveyskirjasto.fi/terveyskirjasto/tk.koti?p_artikkeli=dia00609 | Nimeke = Makeuttajat diabeetikon ruokavaliossa | Tekijä = Heinonen L | Ajankohta = 2011 | Julkaisija = Duodecim | Viitattu =6.8.2013 }}</ref> Sitä valmistetaan [[glukoosi]]sta.<ref>{{Verkkoviite | Osoite = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5780 | Nimeke = Sorbitol - Compound Summary (CID 5780) | Julkaisu = PubChem | Julkaisija = NCBI | Viitattu =6.8.2013 | Kieli = }}</ref> Valmistusprosessissa glukoosi [[hydraus|hydrataan]], jolloin molekyylin [[aldehydi]]ryhmä vaihtuu [[hydroksyyli]]ryhmäksi.
 
121 227

muokkausta