Ero sivun ”Guanosiinitrifosfaatti” versioiden välillä

p
typo
p (Botti poisti 26 Wikidatan sivulle d:q392227 siirrettyä kielilinkkiä)
p (typo)
| smiles = C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N
}}
'''Guanosiinitrifosfaatti''' (guanosiini-5'-trifosfaatti, '''GTP''') on eräs [[puriini]][[nukleotidi]]. GTP toimii substraattina [[RNA]]-synteesissä, samoin kuin [[adenosiinitrifosfaatti]] eli ATP, [[sytidiinitrifosfaatti]] eli CTP ja [[uridiinitrifosfaatti]] eli UTP. GTP on [[guanidiini]]nukleotidi kuten [[guanosiinidifosfaatti]] eli GDP, josta se poikeaapoikkeaa ainoastaan [[fosfaatti]]ryhmien lukumäärän perusteella. GTP toimii myös energianlähteenä ja useiden [[aineenvaihdunta|metabolia]]reaktioiden aktivaattorina. GTP:llä on myös tärkeä tehtävä [[G-proteiini]]en signaalivälityksessä, jossa se muuntuu GDP:ksi [[GTPaasi]]en välityksellä.
 
Guanosiinitrifosfaatin [[kemiallinen kaava]] on C<sub>10</sub>H<sub>16</sub>N<sub>5</sub>O<sub>14</sub>P<sub>3</sub> ja [[moolimassa]] 523,18&nbsp;g/mol. Sen [[CAS-numero]] 86-01-1<ref>{{Verkkoviite | Osoite = http://www.terveysportti.fi/rex/rex.metatesaurus.termi?p_sfui=SF019972&p_cfui=CF005933&p_sab=FINMSH&p_hierarkia=K| Nimeke = Guanosiinitrifosfaatti| Tekijä = | Tiedostomuoto = | Selite = | Julkaisu = terveysportti.fi| Ajankohta = | Julkaisupaikka = | Julkaisija = | Viitattu = 8.7.2010 | Kieli = }}</ref>.
15 435

muokkausta