Ero sivun ”Molindoni” versioiden välillä

772 merkkiä lisätty ,  5 vuotta sitten
Malline
(Aloitettu lääketieteellinen neuroleptistä lääkeainetta käsittelevä minitynkä. Merkitty luokaksi "vain" lääkkeet ja käännös on sekin merk. Formulaarikaavio lis. (skaalattuna).)
 
(Malline)
{{Lääketietolaatikko
[[Tiedosto:Molindone.svg|thumb|180px|Molindonin molekylaarinen rakennekaavio.]]
| IUPAC_nimi = 3-etyyli-2-metyyli-5-(morfolin-4-yylimetyyl)-1,5,6,7-tetrahydroindol-4-oni
 
| image = Molindone.svg
| width = 250
| CAS_numero = 7416-34-4
| ATC_prefiksi = N05
| ATC_suffiksi = AE02
| ATC_lisätiedot =
| PubChem = 23897
| DrugBank = DB01618
| C=16 | H=24 | N=2 | O =2
| moolimassa = 276,374
| smiles = CCC1=C(NC2=C1C(=O)C(CC2)CN3CCOCC3)C
| synonyymit =
| tiheys =
| sulamispiste =
| sulamis_ylempi =
| sulamishuomiot =
| kiehumispiste =
| kiehumis_ylempi =
| kiehumishuomiot =
| liukoisuus =
| biosaatavuus =
| proteiinisitoutuminen =
| metabolismi = [[Maksa|Hepaattinen]]
| eliminaation_puoliintumisaika = 1,5 h
| ekskreetio = [[Munuaiset|Renaalinen]]
| raskaus_AU =
| raskaus_US =
| resepti_AU =
| resepti_CA =
| resepti_UK =
| resepti_US =
| reseptiluokitus =
| valmisteen_antotapa = Oraalinen
}}
'''Molindoni''' (''Moban'') on antipsykoottinen lääke eli [[neurolepti]].
 
125 179

muokkausta