Ero sivun ”Tioridatsiini” versioiden välillä

642 merkkiä lisätty ,  8 vuotta sitten
Malline
p (Botti poisti 8 Wikidatan sivulle d:q58375 siirrettyä kielilinkkiä)
(Malline)
{{Lääketietolaatikko|
[[Tiedosto:Thioridazin Enantiomers Structural Formulae V.1.svg|thumb|400px|Tioridatsiinin rakenne]]
| IUPAC_nimi = 10-[2-(1-metyylipiperidin-2-yyli)etyyli]-2-metyylisulfanyylifenotiatsiini
[[Tiedosto:| kuva = Thioridazin Enantiomers Structural Formulae V.1.svg|thumb|400px|Tioridatsiinin rakenne]]
| kuva2 =
| leveys = 250
| CAS_numero = 50-52-2
| ATC_prefiksi = N05
| ATC_suffiksi = AC02
| ATC_lisätiedot =
| PubChem = 5452
| DrugBank = DB00679
| C=21 | H=26 | N=2 | S=2
| moolimassa = 370,57 g/mol
| smiles = CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)SC
| synonyymit =
| tiheys =
| sulamispiste = 73
| sulamis_ylempi =
| sulamishuomiot =
| kiehumispiste = 230
| kiehumishuomiot =
| liukoisuus =
| biosaatavuus = 60%
| proteiinisitoutuminen = 95%
| metabolismi = [[maksa|Hepaattinen]]
| eliminaation_puoliintumisaika = 21-25 tuntia
| ekskreetio = Ulosteiden mukana
| raskaus_AU =
| raskaus_US =
| resepti_AU =
| resepti_CA =
| resepti_UK =
| resepti_US =
| reseptiluokitus =
| valmisteen_antotapa = Oraalinen
}}
'''Tioridatsiini''' on ns. ensimmäisen polven neuroleptilääke eli [[Antipsykoottinen lääke|antipsykootti]]. Se kuuluu fentiatsiini-lääkeryhmän alalajiin [[piperidiini]]t. Sillä on [[sedatiivi]]sia eli väsyttäviä vaikutuksia. Tioridatsiinia on käyttetty vakavampien psykoosityyppisten häiriöiden hoidon ohella myös nk. pienessä psykiatriassa eli aikaisemmalta nimitykseltään neuroosien hoidossa. Lääkettä on usein käytetty terapian tukena ja univaikeuksien hoitoon. Psykoosien hoidossa tioridatsiinin käyttö voi tulla kyseeseen, kun muut "lievemmät" neuroleptit eivät tehoa. Vastaavasti [[Klotsapiini]]a (Leponex) voi pitää vielä tioridatsiiniakin tehokkaampana, mutta myös huomattavia haittavaikutuksia omaavana, lääkkeenä.<ref> Alfering-Olli-Tuomi: Lääkkeet ja niiden käyttö, SHKS 1977</ref>.
 
 
==Historia==
Suomessa tioridatsiini tuli markkinoille (kauppanimi Orsanil, valmistaja [[Orion-Pharma]]) 60-luvun puolivälin tietämillä, ja se on edelleen käytössä (erityisluvalla). Muita valmistenimiä ovat olleet Melleril ja Stalleril<ref name="tf"> TF74-Therapica Fennica</ref>. Suuremman suosion lääkeaine saavutti 1970- ja 1980-lukujen tietämillä.
. Suuremman suosion lääkeaine saavutti 1970- ja 1980-lukujen tietämillä.
 
Tioridatsiinin [[kemiallinen kaava]] on C<sub>21</sub>H<sub>26</sub>N<sub>2</sub>S<sub>2</sub>, [[moolimassa]] 370,57&nbsp;g/mol ja [[CAS-numero]] 50-52-2.
 
== Lähteet ==
132 511

muokkausta