Ero sivun ”Kurkumiini” versioiden välillä

422 merkkiä lisätty ,  8 vuotta sitten
Malline. Tiedot enwikistä
(Lisäyksiä)
(Malline. Tiedot enwikistä)
{{Orgaaninen yhdiste
[[Kuva:Curcumin.svg|thumb|250px|Kurkumiinin rakenne]]
| nimi = Kurkumiini
| iupac = (1E,6E)-1,7-bis(4-hydroksi-3-metoksifenyyli)hepta-1,6-dieeni-3,5-dioni
| kuva = [[Kuva:CurcuminKeto.svg|200px]]
| cas = 458-37-7
| kaava = C<sub>21</sub>H<sub>20</sub>O<sub>6</sub>
| massa = 368,38 g/mol
| tiheys =
| sulamispiste = 183 °C
| kiehumispiste =
| liukoisuus =
| smiles = COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O
}}
 
'''Kurkumiini''' eli '''diferoyylimetaani''' on [[maustekurkuma]]n (''Curcuma longa'') juurista uutettavaa ainetta, jota käytetään [[elintarvike|elintarvikkeissa]] väriaineena. Kurkumiinin [[E-koodi]] on E 100.
Kurkumiinin uuttamisessa saa käyttää ainoastaan seuraavia liuottimia: [[etyyliasetaatti]], [[asetoni]], [[hiilidioksidi]], [[dikloorimetaani]], [[n-butanoli]], [[metanoli]], [[etanoli]], [[heksaani]], [[2-propanoli]].
127 906

muokkausta